C22H25NO5S — CID 142727983
1-amino-4-octyl-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 142727983) has the molecular formula C22H25NO5S and a molecular weight of 415.51 g/mol. Its IUPAC name is 1-amino-4-octyl-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 1-amino-4-octyl-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 142727983 |
| Molecular Formula | C22H25NO5S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 1-amino-4-octyl-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | CCCCCCCCc1cc(S(=O)(=O)O)c(N)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H25NO5S/c1-2-3-4-5-6-7-10-14-13-17(29(26,27)28)20(23)19-18(14)21(24)15-11-8-9-12-16(15)22(19)25/h8-9,11-13H,2-7,10,23H2,1H3,(H,26,27,28) |
| InChIKey | MAZTWGSRAPJULY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|