C22H20N2O6S2 — CID 174258076
1-amino-4-(anilino-ethyl-hydroxy-λ4-sulfanyl)-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 174258076) has the molecular formula C22H20N2O6S2 and a molecular weight of 472.54 g/mol. Its IUPAC name is 1-amino-4-(anilino-ethyl-hydroxy-λ4-sulfanyl)-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 1-amino-4-(anilino-ethyl-hydroxy-λ4-sulfanyl)-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 174258076 |
| Molecular Formula | C22H20N2O6S2 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | 1-amino-4-(anilino-ethyl-hydroxy-λ4-sulfanyl)-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | CCS(O)(Nc1ccccc1)c1cc(S(=O)(=O)O)c(N)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H20N2O6S2/c1-2-31(27,24-13-8-4-3-5-9-13)16-12-17(32(28,29)30)20(23)19-18(16)21(25)14-10-6-7-11-15(14)22(19)26/h3-12,24,27H,2,23H2,1H3,(H,28,29,30) |
| InChIKey | XMNOUFWTNFHVQD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|