C21H16N2O4S — CID 58420795
1-amino-4-anilino-2-methylsulfonylanthracene-9,10-dione (PubChem CID 58420795) has the molecular formula C21H16N2O4S and a molecular weight of 392.44 g/mol. Its IUPAC name is 1-amino-4-anilino-2-methylsulfonylanthracene-9,10-dione.
| Compound Name | 1-amino-4-anilino-2-methylsulfonylanthracene-9,10-dione |
|---|---|
| PubChem CID | 58420795 |
| Molecular Formula | C21H16N2O4S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 1-amino-4-anilino-2-methylsulfonylanthracene-9,10-dione |
| SMILES | CS(=O)(=O)c1cc(Nc2ccccc2)c2c(c1N)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H16N2O4S/c1-28(26,27)16-11-15(23-12-7-3-2-4-8-12)17-18(19(16)22)21(25)14-10-6-5-9-13(14)20(17)24/h2-11,23H,22H2,1H3 |
| InChIKey | BBRJJISLBNWPDR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|