C20H12N2Na2O8S2 — CID 59448164
disodium;1-amino-9,10-dioxo-4-(4-sulfonatoanilino)anthracene-2-sulfonate (PubChem CID 59448164) has the molecular formula C20H12N2Na2O8S2 and a molecular weight of 518.44 g/mol. Its IUPAC name is disodium;1-amino-9,10-dioxo-4-(4-sulfonatoanilino)anthracene-2-sulfonate.
| Compound Name | disodium;1-amino-9,10-dioxo-4-(4-sulfonatoanilino)anthracene-2-sulfonate |
|---|---|
| PubChem CID | 59448164 |
| Molecular Formula | C20H12N2Na2O8S2 |
| Molecular Weight | 518.44 g/mol |
| Exact Mass | 517.98 |
| IUPAC Name | disodium;1-amino-9,10-dioxo-4-(4-sulfonatoanilino)anthracene-2-sulfonate |
| SMILES | Nc1c(S(=O)(=O)[O-])cc(Nc2ccc(S(=O)(=O)[O-])cc2)c2c1C(=O)c1ccccc1C2=O.[Na+].[Na+] |
| InChI | InChI=1S/C20H14N2O8S2.2Na/c21-18-15(32(28,29)30)9-14(22-10-5-7-11(8-6-10)31(25,26)27)16-17(18)20(24)13-4-2-1-3-12(13)19(16)23;;/h1-9,22H,21H2,(H,25,26,27)(H,28,29,30);;/q;2*+1/p-2 |
| InChIKey | RMYJBERGSQNQGT-UHFFFAOYSA-L |
| XLogP | -4.40 |
| TPSA | 186.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.44 |
| LogP ≤ 5 | -4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|