C22H11F6N2NaO5S — CID 56943845
sodium 1-amino-4-[3,5-bis(trifluoromethyl)anilino]-9,10-dioxoanthracene-2-sulfonate (PubChem CID 56943845) has the molecular formula C22H11F6N2NaO5S and a molecular weight of 552.38 g/mol. Its IUPAC name is sodium 1-amino-4-[3,5-bis(trifluoromethyl)anilino]-9,10-dioxoanthracene-2-sulfonate.
| Compound Name | sodium 1-amino-4-[3,5-bis(trifluoromethyl)anilino]-9,10-dioxoanthracene-2-sulfonate |
|---|---|
| PubChem CID | 56943845 |
| Molecular Formula | C22H11F6N2NaO5S |
| Molecular Weight | 552.38 g/mol |
| Exact Mass | 552.02 |
| IUPAC Name | sodium 1-amino-4-[3,5-bis(trifluoromethyl)anilino]-9,10-dioxoanthracene-2-sulfonate |
| SMILES | Nc1c(S(=O)(=O)[O-])cc(Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2c1C(=O)c1ccccc1C2=O.[Na+] |
| InChI | InChI=1S/C22H12F6N2O5S.Na/c23-21(24,25)9-5-10(22(26,27)28)7-11(6-9)30-14-8-15(36(33,34)35)18(29)17-16(14)19(31)12-3-1-2-4-13(12)20(17)32;/h1-8,30H,29H2,(H,33,34,35);/q;+1/p-1 |
| InChIKey | YSLBUQYDTGCOQB-UHFFFAOYSA-M |
| XLogP | 1.73 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|