C22H16N3O6S- — CID 23466350
4-(3-acetamidoanilino)-1-amino-9,10-dioxoanthracene-2-sulfonate (PubChem CID 23466350) has the molecular formula C22H16N3O6S- and a molecular weight of 450.45 g/mol. Its IUPAC name is 4-(3-acetamidoanilino)-1-amino-9,10-dioxoanthracene-2-sulfonate.
| Compound Name | 4-(3-acetamidoanilino)-1-amino-9,10-dioxoanthracene-2-sulfonate |
|---|---|
| PubChem CID | 23466350 |
| Molecular Formula | C22H16N3O6S- |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 4-(3-acetamidoanilino)-1-amino-9,10-dioxoanthracene-2-sulfonate |
| SMILES | CC(=O)Nc1cccc(Nc2cc(S(=O)(=O)[O-])c(N)c3c2C(=O)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C22H17N3O6S/c1-11(26)24-12-5-4-6-13(9-12)25-16-10-17(32(29,30)31)20(23)19-18(16)21(27)14-7-2-3-8-15(14)22(19)28/h2-10,25H,23H2,1H3,(H,24,26)(H,29,30,31)/p-1 |
| InChIKey | TXLJHCHWQDGXMM-UHFFFAOYSA-M |
| XLogP | 2.65 |
| TPSA | 158.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|