C33H28N10O6S — CID 87648857
1-amino-4-[3-[[4-hydrazinyl-6-[3-(2-methylprop-2-enoylamino)anilino]-1,3,5-triazin-2-yl]amino]anilino]-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 87648857) has the molecular formula C33H28N10O6S and a molecular weight of 692.72 g/mol. Its IUPAC name is 1-amino-4-[3-[[4-hydrazinyl-6-[3-(2-methylprop-2-enoylamino)anilino]-1,3,5-triazin-2-yl]amino]anilino]-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 1-amino-4-[3-[[4-hydrazinyl-6-[3-(2-methylprop-2-enoylamino)anilino]-1,3,5-triazin-2-yl]amino]anilino]-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 87648857 |
| Molecular Formula | C33H28N10O6S |
| Molecular Weight | 692.72 g/mol |
| Exact Mass | 692.19 |
| IUPAC Name | 1-amino-4-[3-[[4-hydrazinyl-6-[3-(2-methylprop-2-enoylamino)anilino]-1,3,5-triazin-2-yl]amino]anilino]-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | C=C(C)C(=O)Nc1cccc(Nc2nc(NN)nc(Nc3cccc(Nc4cc(S(=O)(=O)O)c(N)c5c4C(=O)c4ccccc4C5=O)c3)n2)c1 |
| InChI | InChI=1S/C33H28N10O6S/c1-16(2)30(46)37-18-8-6-10-20(14-18)39-32-40-31(41-33(42-32)43-35)38-19-9-5-7-17(13-19)36-23-15-24(50(47,48)49)27(34)26-25(23)28(44)21-11-3-4-12-22(21)29(26)45/h3-15,36H,1,34-35H2,2H3,(H,37,46)(H,47,48,49)(H3,38,39,40,41,42,43) |
| InChIKey | ROIOVRRGKHYGGJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 256.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.72 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|