C23H16BrN3Na2O9S2 — CID 170840239
CID 170840239 (PubChem CID 170840239) has the molecular formula C23H16BrN3Na2O9S2 and a molecular weight of 668.41 g/mol.
| Compound Name | CID 170840239 |
|---|---|
| PubChem CID | 170840239 |
| Molecular Formula | C23H16BrN3Na2O9S2 |
| Molecular Weight | 668.41 g/mol |
| Exact Mass | 666.93 |
| IUPAC Name | — |
| SMILES | C=C(Br)C(=O)Nc1ccc(Nc2cc(S(=O)(=O)O)c(N)c3c2C(=O)c2ccccc2C3=O)c(S(=O)(=O)O)c1.[Na].[Na] |
| InChI | InChI=1S/C23H16BrN3O9S2.2Na/c1-10(24)23(30)26-11-6-7-14(16(8-11)37(31,32)33)27-15-9-17(38(34,35)36)20(25)19-18(15)21(28)12-4-2-3-5-13(12)22(19)29;;/h2-9,27H,1,25H2,(H,26,30)(H,31,32,33)(H,34,35,36);; |
| InChIKey | LLTLJTMFIUQWBG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 210.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|