C30H23N5O13S3 — CID 135597721
2-[(4-amino-9,10-dioxo-3-sulfoanthracen-1-yl)amino]-5-[[(E)-1-anilino-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]benzene-1,4-disulfonic acid (PubChem CID 135597721) has the molecular formula C30H23N5O13S3 and a molecular weight of 757.74 g/mol. Its IUPAC name is 2-[(4-amino-9,10-dioxo-3-sulfoanthracen-1-yl)amino]-5-[[(E)-1-anilino-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]benzene-1,4-disulfonic acid.
| Compound Name | 2-[(4-amino-9,10-dioxo-3-sulfoanthracen-1-yl)amino]-5-[[(E)-1-anilino-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 135597721 |
| Molecular Formula | C30H23N5O13S3 |
| Molecular Weight | 757.74 g/mol |
| Exact Mass | 757.05 |
| IUPAC Name | 2-[(4-amino-9,10-dioxo-3-sulfoanthracen-1-yl)amino]-5-[[(E)-1-anilino-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]benzene-1,4-disulfonic acid |
| SMILES | C/C(O)=C(\N=N\c1cc(S(=O)(=O)O)c(Nc2cc(S(=O)(=O)O)c(N)c3c2C(=O)c2ccccc2C3=O)cc1S(=O)(=O)O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C30H23N5O13S3/c1-14(36)27(30(39)32-15-7-3-2-4-8-15)35-34-19-12-21(49(40,41)42)18(11-22(19)50(43,44)45)33-20-13-23(51(46,47)48)26(31)25-24(20)28(37)16-9-5-6-10-17(16)29(25)38/h2-13,33,36H,31H2,1H3,(H,32,39)(H,40,41,42)(H,43,44,45)(H,46,47,48)/b27-14+,35-34+ |
| InChIKey | QVRAGAGCVMNXOD-NRGQBOEKSA-N |
| XLogP | 4.04 |
| TPSA | 309.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.74 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|