C16H14ClN3O6S — CID 177442987
3-[[(Z)-1-anilino-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]-5-chloro-2-hydroxybenzenesulfonic acid (PubChem CID 177442987) has the molecular formula C16H14ClN3O6S and a molecular weight of 411.82 g/mol. Its IUPAC name is 3-[[(Z)-1-anilino-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]-5-chloro-2-hydroxybenzenesulfonic acid.
| Compound Name | 3-[[(Z)-1-anilino-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]-5-chloro-2-hydroxybenzenesulfonic acid |
|---|---|
| PubChem CID | 177442987 |
| Molecular Formula | C16H14ClN3O6S |
| Molecular Weight | 411.82 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | 3-[[(Z)-1-anilino-3-hydroxy-1-oxobut-2-en-2-yl]diazenyl]-5-chloro-2-hydroxybenzenesulfonic acid |
| SMILES | C/C(O)=C(/N=N/c1cc(Cl)cc(S(=O)(=O)O)c1O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H14ClN3O6S/c1-9(21)14(16(23)18-11-5-3-2-4-6-11)20-19-12-7-10(17)8-13(15(12)22)27(24,25)26/h2-8,21-22H,1H3,(H,18,23)(H,24,25,26)/b14-9-,20-19+ |
| InChIKey | MFEKEGYHFDHBTC-UJSDLYDJSA-N |
| XLogP | 3.80 |
| TPSA | 148.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.82 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|