C24H23ClN4O5S — CID 135815638
(Z)-N-(4-chlorophenyl)-3-hydroxy-2-[[3-[(2-methoxyphenyl)sulfamoyl]-4-methylphenyl]diazenyl]but-2-enamide (PubChem CID 135815638) has the molecular formula C24H23ClN4O5S and a molecular weight of 514.99 g/mol. Its IUPAC name is (Z)-N-(4-chlorophenyl)-3-hydroxy-2-[[3-[(2-methoxyphenyl)sulfamoyl]-4-methylphenyl]diazenyl]but-2-enamide.
| Compound Name | (Z)-N-(4-chlorophenyl)-3-hydroxy-2-[[3-[(2-methoxyphenyl)sulfamoyl]-4-methylphenyl]diazenyl]but-2-enamide |
|---|---|
| PubChem CID | 135815638 |
| Molecular Formula | C24H23ClN4O5S |
| Molecular Weight | 514.99 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | (Z)-N-(4-chlorophenyl)-3-hydroxy-2-[[3-[(2-methoxyphenyl)sulfamoyl]-4-methylphenyl]diazenyl]but-2-enamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc(/N=N/C(C(=O)Nc2ccc(Cl)cc2)=C(/C)O)ccc1C |
| InChI | InChI=1S/C24H23ClN4O5S/c1-15-8-11-19(14-22(15)35(32,33)29-20-6-4-5-7-21(20)34-3)27-28-23(16(2)30)24(31)26-18-12-9-17(25)10-13-18/h4-14,29-30H,1-3H3,(H,26,31)/b23-16-,28-27+ |
| InChIKey | PBMOBTDPKWGVHN-NJDIXKAJSA-N |
| XLogP | 5.97 |
| TPSA | 129.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.99 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|