C28H28N6O6S — CID 135535489
2-[[3-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)sulfamoyl]phenyl]diazenyl]-3-hydroxy-N-(2-methoxyphenyl)but-2-enamide (PubChem CID 135535489) has the molecular formula C28H28N6O6S and a molecular weight of 576.64 g/mol. Its IUPAC name is 2-[[3-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)sulfamoyl]phenyl]diazenyl]-3-hydroxy-N-(2-methoxyphenyl)but-2-enamide.
| Compound Name | 2-[[3-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)sulfamoyl]phenyl]diazenyl]-3-hydroxy-N-(2-methoxyphenyl)but-2-enamide |
|---|---|
| PubChem CID | 135535489 |
| Molecular Formula | C28H28N6O6S |
| Molecular Weight | 576.64 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | 2-[[3-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)sulfamoyl]phenyl]diazenyl]-3-hydroxy-N-(2-methoxyphenyl)but-2-enamide |
| SMILES | COc1ccccc1NC(=O)C(/N=N/c1cccc(S(=O)(=O)Nc2c(C)n(C)n(-c3ccccc3)c2=O)c1)=C(C)O |
| InChI | InChI=1S/C28H28N6O6S/c1-18-25(28(37)34(33(18)3)21-12-6-5-7-13-21)32-41(38,39)22-14-10-11-20(17-22)30-31-26(19(2)35)27(36)29-23-15-8-9-16-24(23)40-4/h5-17,32,35H,1-4H3,(H,29,36)/b26-19?,31-30+ |
| InChIKey | WGRHYWBBWFAAGG-KKSHLLEZSA-N |
| XLogP | 4.81 |
| TPSA | 156.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.64 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|