C25H19N3O5S — CID 3636957
N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-9,10-dioxoanthracene-2-sulfonamide (PubChem CID 3636957) has the molecular formula C25H19N3O5S and a molecular weight of 473.51 g/mol. Its IUPAC name is N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-9,10-dioxoanthracene-2-sulfonamide.
| Compound Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-9,10-dioxoanthracene-2-sulfonamide |
|---|---|
| PubChem CID | 3636957 |
| Molecular Formula | C25H19N3O5S |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-9,10-dioxoanthracene-2-sulfonamide |
| SMILES | Cc1c(NS(=O)(=O)c2ccc3c(c2)C(=O)c2ccccc2C3=O)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C25H19N3O5S/c1-15-22(25(31)28(27(15)2)16-8-4-3-5-9-16)26-34(32,33)17-12-13-20-21(14-17)24(30)19-11-7-6-10-18(19)23(20)29/h3-14,26H,1-2H3 |
| InChIKey | WXJOTUYESHTANR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 107.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|