C24H19N3O4S — CID 3658051
N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-9-oxofluorene-2-sulfonamide (PubChem CID 3658051) has the molecular formula C24H19N3O4S and a molecular weight of 445.50 g/mol. Its IUPAC name is N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-9-oxofluorene-2-sulfonamide.
| Compound Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-9-oxofluorene-2-sulfonamide |
|---|---|
| PubChem CID | 3658051 |
| Molecular Formula | C24H19N3O4S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-9-oxofluorene-2-sulfonamide |
| SMILES | Cc1c(NS(=O)(=O)c2ccc3c(c2)C(=O)c2ccccc2-3)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C24H19N3O4S/c1-15-22(24(29)27(26(15)2)16-8-4-3-5-9-16)25-32(30,31)17-12-13-19-18-10-6-7-11-20(18)23(28)21(19)14-17/h3-14,25H,1-2H3 |
| InChIKey | FMGOSHVFQNNSGM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |