C26H27N5O4S2 — CID 25043553
1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[2-[(2-methoxyphenyl)sulfamoyl]-4-methylphenyl]thiourea (PubChem CID 25043553) has the molecular formula C26H27N5O4S2 and a molecular weight of 537.67 g/mol. Its IUPAC name is 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[2-[(2-methoxyphenyl)sulfamoyl]-4-methylphenyl]thiourea.
| Compound Name | 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[2-[(2-methoxyphenyl)sulfamoyl]-4-methylphenyl]thiourea |
|---|---|
| PubChem CID | 25043553 |
| Molecular Formula | C26H27N5O4S2 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[2-[(2-methoxyphenyl)sulfamoyl]-4-methylphenyl]thiourea |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc(C)ccc1NC(=S)Nc1c(C)n(C)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C26H27N5O4S2/c1-17-14-15-21(23(16-17)37(33,34)29-20-12-8-9-13-22(20)35-4)27-26(36)28-24-18(2)30(3)31(25(24)32)19-10-6-5-7-11-19/h5-16,29H,1-4H3,(H2,27,28,36) |
| InChIKey | DFWWRSYKMQZPNA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|