C24H25N7O5S2 — CID 134131342
1-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)thiourea (PubChem CID 134131342) has the molecular formula C24H25N7O5S2 and a molecular weight of 555.64 g/mol. Its IUPAC name is 1-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)thiourea.
| Compound Name | 1-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)thiourea |
|---|---|
| PubChem CID | 134131342 |
| Molecular Formula | C24H25N7O5S2 |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | 1-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)thiourea |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(NC(=S)Nc3c(C)n(C)n(-c4ccccc4)c3=O)cc2)nc(OC)n1 |
| InChI | InChI=1S/C24H25N7O5S2/c1-15-21(22(32)31(30(15)2)17-8-6-5-7-9-17)28-24(37)25-16-10-12-18(13-11-16)38(33,34)29-19-14-20(35-3)27-23(26-19)36-4/h5-14H,1-4H3,(H2,25,28,37)(H,26,27,29) |
| InChIKey | OQFPUSKSQZGAAT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 141.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|