C24H25N7O3S2 — CID 25039554
1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]thiourea (PubChem CID 25039554) has the molecular formula C24H25N7O3S2 and a molecular weight of 523.64 g/mol. Its IUPAC name is 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]thiourea.
| Compound Name | 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]thiourea |
|---|---|
| PubChem CID | 25039554 |
| Molecular Formula | C24H25N7O3S2 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]thiourea |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(NC(=S)Nc3c(C)n(C)n(-c4ccccc4)c3=O)cc2)n1 |
| InChI | InChI=1S/C24H25N7O3S2/c1-15-14-16(2)26-23(25-15)29-36(33,34)20-12-10-18(11-13-20)27-24(35)28-21-17(3)30(4)31(22(21)32)19-8-6-5-7-9-19/h5-14H,1-4H3,(H,25,26,29)(H2,27,28,35) |
| InChIKey | SCCUKMSPNQZFSK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 122.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|