C20H22N4O3S — CID 19687077
1-(3,5-dimethoxyphenyl)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)thiourea (PubChem CID 19687077) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)thiourea.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)thiourea |
|---|---|
| PubChem CID | 19687077 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)thiourea |
| SMILES | COc1cc(NC(=S)Nc2c(C)n(C)n(-c3ccccc3)c2=O)cc(OC)c1 |
| InChI | InChI=1S/C20H22N4O3S/c1-13-18(19(25)24(23(13)2)15-8-6-5-7-9-15)22-20(28)21-14-10-16(26-3)12-17(11-14)27-4/h5-12H,1-4H3,(H2,21,22,28) |
| InChIKey | JKPUYDKTBQVYLX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 69.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|