C22H22Cl3N5O3S — CID 1132282
4-methoxy-N-[(1S)-2,2,2-trichloro-1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)carbamothioylamino]ethyl]benzamide (PubChem CID 1132282) has the molecular formula C22H22Cl3N5O3S and a molecular weight of 542.88 g/mol. Its IUPAC name is 4-methoxy-N-[(1S)-2,2,2-trichloro-1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)carbamothioylamino]ethyl]benzamide.
| Compound Name | 4-methoxy-N-[(1S)-2,2,2-trichloro-1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)carbamothioylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 1132282 |
| Molecular Formula | C22H22Cl3N5O3S |
| Molecular Weight | 542.88 g/mol |
| Exact Mass | 541.05 |
| IUPAC Name | 4-methoxy-N-[(1S)-2,2,2-trichloro-1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)carbamothioylamino]ethyl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@@H](NC(=S)Nc2c(C)n(C)n(-c3ccccc3)c2=O)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C22H22Cl3N5O3S/c1-13-17(19(32)30(29(13)2)15-7-5-4-6-8-15)26-21(34)28-20(22(23,24)25)27-18(31)14-9-11-16(33-3)12-10-14/h4-12,20H,1-3H3,(H,27,31)(H2,26,28,34)/t20-/m0/s1 |
| InChIKey | WOLRTYKJTDWYGN-FQEVSTJZSA-N |
| XLogP | 3.91 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.88 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|