C20H19Cl3N4O2 — CID 1105643
N-[(1S)-2,2,2-trichloro-1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]ethyl]benzamide (PubChem CID 1105643) has the molecular formula C20H19Cl3N4O2 and a molecular weight of 453.76 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]ethyl]benzamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 1105643 |
| Molecular Formula | C20H19Cl3N4O2 |
| Molecular Weight | 453.76 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]ethyl]benzamide |
| SMILES | Cc1c(N[C@@H](NC(=O)c2ccccc2)C(Cl)(Cl)Cl)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C20H19Cl3N4O2/c1-13-16(18(29)27(26(13)2)15-11-7-4-8-12-15)24-19(20(21,22)23)25-17(28)14-9-5-3-6-10-14/h3-12,19,24H,1-2H3,(H,25,28)/t19-/m0/s1 |
| InChIKey | HNKCRSOXDGVYPZ-IBGZPJMESA-N |
| XLogP | 4.02 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.76 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|