C21H21Cl3N4O2 — CID 3096956
2-phenyl-N-[2,2,2-trichloro-1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]ethyl]acetamide (PubChem CID 3096956) has the molecular formula C21H21Cl3N4O2 and a molecular weight of 467.78 g/mol. Its IUPAC name is 2-phenyl-N-[2,2,2-trichloro-1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]ethyl]acetamide.
| Compound Name | 2-phenyl-N-[2,2,2-trichloro-1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 3096956 |
| Molecular Formula | C21H21Cl3N4O2 |
| Molecular Weight | 467.78 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | 2-phenyl-N-[2,2,2-trichloro-1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]ethyl]acetamide |
| SMILES | Cc1c(NC(NC(=O)Cc2ccccc2)C(Cl)(Cl)Cl)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C21H21Cl3N4O2/c1-14-18(19(30)28(27(14)2)16-11-7-4-8-12-16)26-20(21(22,23)24)25-17(29)13-15-9-5-3-6-10-15/h3-12,20,26H,13H2,1-2H3,(H,25,29) |
| InChIKey | PUYXJLVIHLVCBW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.78 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|