C22H21Cl3N4O2 — CID 1132289
(E)-3-phenyl-N-[(1R)-2,2,2-trichloro-1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]ethyl]prop-2-enamide (PubChem CID 1132289) has the molecular formula C22H21Cl3N4O2 and a molecular weight of 479.80 g/mol. Its IUPAC name is (E)-3-phenyl-N-[(1R)-2,2,2-trichloro-1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]ethyl]prop-2-enamide.
| Compound Name | (E)-3-phenyl-N-[(1R)-2,2,2-trichloro-1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 1132289 |
| Molecular Formula | C22H21Cl3N4O2 |
| Molecular Weight | 479.80 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | (E)-3-phenyl-N-[(1R)-2,2,2-trichloro-1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]ethyl]prop-2-enamide |
| SMILES | Cc1c(N[C@H](NC(=O)/C=C/c2ccccc2)C(Cl)(Cl)Cl)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C22H21Cl3N4O2/c1-15-19(20(31)29(28(15)2)17-11-7-4-8-12-17)27-21(22(23,24)25)26-18(30)14-13-16-9-5-3-6-10-16/h3-14,21,27H,1-2H3,(H,26,30)/b14-13+/t21-/m0/s1 |
| InChIKey | WJHOZBQENXJHHU-ARKBFRDHSA-N |
| XLogP | 4.42 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.80 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|