C22H22Cl3N5O2S — CID 1132266
3-methyl-N-[(1S)-2,2,2-trichloro-1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)carbamothioylamino]ethyl]benzamide (PubChem CID 1132266) has the molecular formula C22H22Cl3N5O2S and a molecular weight of 526.88 g/mol. Its IUPAC name is 3-methyl-N-[(1S)-2,2,2-trichloro-1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)carbamothioylamino]ethyl]benzamide.
| Compound Name | 3-methyl-N-[(1S)-2,2,2-trichloro-1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)carbamothioylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 1132266 |
| Molecular Formula | C22H22Cl3N5O2S |
| Molecular Weight | 526.88 g/mol |
| Exact Mass | 525.06 |
| IUPAC Name | 3-methyl-N-[(1S)-2,2,2-trichloro-1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)carbamothioylamino]ethyl]benzamide |
| SMILES | Cc1cccc(C(=O)N[C@@H](NC(=S)Nc2c(C)n(C)n(-c3ccccc3)c2=O)C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C22H22Cl3N5O2S/c1-13-8-7-9-15(12-13)18(31)27-20(22(23,24)25)28-21(33)26-17-14(2)29(3)30(19(17)32)16-10-5-4-6-11-16/h4-12,20H,1-3H3,(H,27,31)(H2,26,28,33)/t20-/m0/s1 |
| InChIKey | PDXMGXIPSHFHHG-FQEVSTJZSA-N |
| XLogP | 4.21 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.88 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|