C19H18Cl3N5O3S — CID 1048539
N-[(1R)-2,2,2-trichloro-1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)carbamothioylamino]ethyl]furan-2-carboxamide (PubChem CID 1048539) has the molecular formula C19H18Cl3N5O3S and a molecular weight of 502.81 g/mol. Its IUPAC name is N-[(1R)-2,2,2-trichloro-1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)carbamothioylamino]ethyl]furan-2-carboxamide.
| Compound Name | N-[(1R)-2,2,2-trichloro-1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)carbamothioylamino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1048539 |
| Molecular Formula | C19H18Cl3N5O3S |
| Molecular Weight | 502.81 g/mol |
| Exact Mass | 501.02 |
| IUPAC Name | N-[(1R)-2,2,2-trichloro-1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)carbamothioylamino]ethyl]furan-2-carboxamide |
| SMILES | Cc1c(NC(=S)N[C@@H](NC(=O)c2ccco2)C(Cl)(Cl)Cl)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C19H18Cl3N5O3S/c1-11-14(16(29)27(26(11)2)12-7-4-3-5-8-12)23-18(31)25-17(19(20,21)22)24-15(28)13-9-6-10-30-13/h3-10,17H,1-2H3,(H,24,28)(H2,23,25,31)/t17-/m1/s1 |
| InChIKey | QPKJDLNVFMAUGV-QGZVFWFLSA-N |
| XLogP | 3.49 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.81 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|