C16H16Cl3N3O2S — CID 2829926
N-[2,2,2-trichloro-1-[(2,4-dimethylphenyl)carbamothioylamino]ethyl]furan-2-carboxamide (PubChem CID 2829926) has the molecular formula C16H16Cl3N3O2S and a molecular weight of 420.75 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-[(2,4-dimethylphenyl)carbamothioylamino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2,2,2-trichloro-1-[(2,4-dimethylphenyl)carbamothioylamino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2829926 |
| Molecular Formula | C16H16Cl3N3O2S |
| Molecular Weight | 420.75 g/mol |
| Exact Mass | 419.00 |
| IUPAC Name | N-[2,2,2-trichloro-1-[(2,4-dimethylphenyl)carbamothioylamino]ethyl]furan-2-carboxamide |
| SMILES | Cc1ccc(NC(=S)NC(NC(=O)c2ccco2)C(Cl)(Cl)Cl)c(C)c1 |
| InChI | InChI=1S/C16H16Cl3N3O2S/c1-9-5-6-11(10(2)8-9)20-15(25)22-14(16(17,18)19)21-13(23)12-4-3-7-24-12/h3-8,14H,1-2H3,(H,21,23)(H2,20,22,25) |
| InChIKey | XBTWFVDSPINUEA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.75 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|