C18H16Cl5N3OS — CID 5064195
2,4-dichloro-N-[2,2,2-trichloro-1-[(2,4-dimethylphenyl)carbamothioylamino]ethyl]benzamide (PubChem CID 5064195) has the molecular formula C18H16Cl5N3OS and a molecular weight of 499.68 g/mol. Its IUPAC name is 2,4-dichloro-N-[2,2,2-trichloro-1-[(2,4-dimethylphenyl)carbamothioylamino]ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2,2,2-trichloro-1-[(2,4-dimethylphenyl)carbamothioylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 5064195 |
| Molecular Formula | C18H16Cl5N3OS |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 496.95 |
| IUPAC Name | 2,4-dichloro-N-[2,2,2-trichloro-1-[(2,4-dimethylphenyl)carbamothioylamino]ethyl]benzamide |
| SMILES | Cc1ccc(NC(=S)NC(NC(=O)c2ccc(Cl)cc2Cl)C(Cl)(Cl)Cl)c(C)c1 |
| InChI | InChI=1S/C18H16Cl5N3OS/c1-9-3-6-14(10(2)7-9)24-17(28)26-16(18(21,22)23)25-15(27)12-5-4-11(19)8-13(12)20/h3-8,16H,1-2H3,(H,25,27)(H2,24,26,28) |
| InChIKey | IGKUOGDLEQMYES-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|