C16H15Cl3N4O3S — CID 1106755
N-[(1R)-1-[(4-acetamidophenyl)carbamothioylamino]-2,2,2-trichloroethyl]furan-2-carboxamide (PubChem CID 1106755) has the molecular formula C16H15Cl3N4O3S and a molecular weight of 449.75 g/mol. Its IUPAC name is N-[(1R)-1-[(4-acetamidophenyl)carbamothioylamino]-2,2,2-trichloroethyl]furan-2-carboxamide.
| Compound Name | N-[(1R)-1-[(4-acetamidophenyl)carbamothioylamino]-2,2,2-trichloroethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1106755 |
| Molecular Formula | C16H15Cl3N4O3S |
| Molecular Weight | 449.75 g/mol |
| Exact Mass | 447.99 |
| IUPAC Name | N-[(1R)-1-[(4-acetamidophenyl)carbamothioylamino]-2,2,2-trichloroethyl]furan-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=S)N[C@@H](NC(=O)c2ccco2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H15Cl3N4O3S/c1-9(24)20-10-4-6-11(7-5-10)21-15(27)23-14(16(17,18)19)22-13(25)12-3-2-8-26-12/h2-8,14H,1H3,(H,20,24)(H,22,25)(H2,21,23,27)/t14-/m1/s1 |
| InChIKey | DRCZNVQJVYSUGH-CQSZACIVSA-N |
| XLogP | 3.65 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.75 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|