C18H19N5O5S2 — CID 3831711
1-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-3-(furan-2-ylmethyl)thiourea (PubChem CID 3831711) has the molecular formula C18H19N5O5S2 and a molecular weight of 449.51 g/mol. Its IUPAC name is 1-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3831711 |
| Molecular Formula | C18H19N5O5S2 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 1-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-3-(furan-2-ylmethyl)thiourea |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(NC(=S)NCc3ccco3)cc2)nc(OC)n1 |
| InChI | InChI=1S/C18H19N5O5S2/c1-26-16-10-15(21-17(22-16)27-2)23-30(24,25)14-7-5-12(6-8-14)20-18(29)19-11-13-4-3-9-28-13/h3-10H,11H2,1-2H3,(H2,19,20,29)(H,21,22,23) |
| InChIKey | FVRJESNZSDHGHK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|