C19H18FN5O4S2 — CID 4985480
1-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-3-(4-fluorophenyl)thiourea (PubChem CID 4985480) has the molecular formula C19H18FN5O4S2 and a molecular weight of 463.52 g/mol. Its IUPAC name is 1-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 4985480 |
| Molecular Formula | C19H18FN5O4S2 |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | 1-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-3-(4-fluorophenyl)thiourea |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(NC(=S)Nc3ccc(F)cc3)cc2)nc(OC)n1 |
| InChI | InChI=1S/C19H18FN5O4S2/c1-28-17-11-16(23-18(24-17)29-2)25-31(26,27)15-9-7-14(8-10-15)22-19(30)21-13-5-3-12(20)4-6-13/h3-11H,1-2H3,(H2,21,22,30)(H,23,24,25) |
| InChIKey | TYOJGONQMILWQM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|