C23H17N2NaO5S — CID 56944131
sodium 1-amino-4-(2,3-dihydro-1H-inden-5-ylamino)-9,10-dioxoanthracene-2-sulfonate (PubChem CID 56944131) has the molecular formula C23H17N2NaO5S and a molecular weight of 456.46 g/mol. Its IUPAC name is sodium 1-amino-4-(2,3-dihydro-1H-inden-5-ylamino)-9,10-dioxoanthracene-2-sulfonate.
| Compound Name | sodium 1-amino-4-(2,3-dihydro-1H-inden-5-ylamino)-9,10-dioxoanthracene-2-sulfonate |
|---|---|
| PubChem CID | 56944131 |
| Molecular Formula | C23H17N2NaO5S |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | sodium 1-amino-4-(2,3-dihydro-1H-inden-5-ylamino)-9,10-dioxoanthracene-2-sulfonate |
| SMILES | Nc1c(S(=O)(=O)[O-])cc(Nc2ccc3c(c2)CCC3)c2c1C(=O)c1ccccc1C2=O.[Na+] |
| InChI | InChI=1S/C23H18N2O5S.Na/c24-21-18(31(28,29)30)11-17(25-14-9-8-12-4-3-5-13(12)10-14)19-20(21)23(27)16-7-2-1-6-15(16)22(19)26;/h1-2,6-11,25H,3-5,24H2,(H,28,29,30);/q;+1/p-1 |
| InChIKey | BEALARWICOPIMN-UHFFFAOYSA-M |
| XLogP | 0.18 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|