C20H13N2NaO2S — CID 102057908
sodium 1-amino-4-anilino-9,10-dioxoanthracene-2-thiolate (PubChem CID 102057908) has the molecular formula C20H13N2NaO2S and a molecular weight of 368.39 g/mol. Its IUPAC name is sodium 1-amino-4-anilino-9,10-dioxoanthracene-2-thiolate.
| Compound Name | sodium 1-amino-4-anilino-9,10-dioxoanthracene-2-thiolate |
|---|---|
| PubChem CID | 102057908 |
| Molecular Formula | C20H13N2NaO2S |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | sodium 1-amino-4-anilino-9,10-dioxoanthracene-2-thiolate |
| SMILES | Nc1c([S-])cc(Nc2ccccc2)c2c1C(=O)c1ccccc1C2=O.[Na+] |
| InChI | InChI=1S/C20H14N2O2S.Na/c21-18-15(25)10-14(22-11-6-2-1-3-7-11)16-17(18)20(24)13-9-5-4-8-12(13)19(16)23;/h1-10,22,25H,21H2;/q;+1/p-1 |
| InChIKey | CRQIGOAHMKQXGQ-UHFFFAOYSA-M |
| XLogP | 0.70 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|