C25H27N3O3 — CID 158516928
1-amino-4-anilino-2-[2-(dimethylamino)ethoxy]anthracene-9,10-dione;methane (PubChem CID 158516928) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 1-amino-4-anilino-2-[2-(dimethylamino)ethoxy]anthracene-9,10-dione;methane.
| Compound Name | 1-amino-4-anilino-2-[2-(dimethylamino)ethoxy]anthracene-9,10-dione;methane |
|---|---|
| PubChem CID | 158516928 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 1-amino-4-anilino-2-[2-(dimethylamino)ethoxy]anthracene-9,10-dione;methane |
| SMILES | C.CN(C)CCOc1cc(Nc2ccccc2)c2c(c1N)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H23N3O3.CH4/c1-27(2)12-13-30-19-14-18(26-15-8-4-3-5-9-15)20-21(22(19)25)24(29)17-11-7-6-10-16(17)23(20)28;/h3-11,14,26H,12-13,25H2,1-2H3;1H4 |
| InChIKey | HLSWYLBMEGLSKL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|