C34H27BrN4O3 — CID 70539400
1,5-diamino-2-bromo-4,8-bis(4-methylanilino)-6-phenoxyanthracene-9,10-dione (PubChem CID 70539400) has the molecular formula C34H27BrN4O3 and a molecular weight of 619.52 g/mol. Its IUPAC name is 1,5-diamino-2-bromo-4,8-bis(4-methylanilino)-6-phenoxyanthracene-9,10-dione.
| Compound Name | 1,5-diamino-2-bromo-4,8-bis(4-methylanilino)-6-phenoxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 70539400 |
| Molecular Formula | C34H27BrN4O3 |
| Molecular Weight | 619.52 g/mol |
| Exact Mass | 618.13 |
| IUPAC Name | 1,5-diamino-2-bromo-4,8-bis(4-methylanilino)-6-phenoxyanthracene-9,10-dione |
| SMILES | Cc1ccc(Nc2cc(Br)c(N)c3c2C(=O)c2c(N)c(Oc4ccccc4)cc(Nc4ccc(C)cc4)c2C3=O)cc1 |
| InChI | InChI=1S/C34H27BrN4O3/c1-18-8-12-20(13-9-18)38-24-16-23(35)31(36)29-27(24)34(41)30-28(33(29)40)25(39-21-14-10-19(2)11-15-21)17-26(32(30)37)42-22-6-4-3-5-7-22/h3-17,38-39H,36-37H2,1-2H3 |
| InChIKey | SACDREAVQWKHOC-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.52 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|