C40H32N4O8S2 — CID 23323267
N-[4,8-diamino-5-[(4-methylphenyl)sulfonylamino]-9,10-dioxo-3,7-diphenoxyanthracen-1-yl]-4-methylbenzenesulfonamide (PubChem CID 23323267) has the molecular formula C40H32N4O8S2 and a molecular weight of 760.85 g/mol. Its IUPAC name is N-[4,8-diamino-5-[(4-methylphenyl)sulfonylamino]-9,10-dioxo-3,7-diphenoxyanthracen-1-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[4,8-diamino-5-[(4-methylphenyl)sulfonylamino]-9,10-dioxo-3,7-diphenoxyanthracen-1-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 23323267 |
| Molecular Formula | C40H32N4O8S2 |
| Molecular Weight | 760.85 g/mol |
| Exact Mass | 760.17 |
| IUPAC Name | N-[4,8-diamino-5-[(4-methylphenyl)sulfonylamino]-9,10-dioxo-3,7-diphenoxyanthracen-1-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(Oc3ccccc3)c(N)c3c2C(=O)c2c(N)c(Oc4ccccc4)cc(NS(=O)(=O)c4ccc(C)cc4)c2C3=O)cc1 |
| InChI | InChI=1S/C40H32N4O8S2/c1-23-13-17-27(18-14-23)53(47,48)43-29-21-31(51-25-9-5-3-6-10-25)37(41)35-33(29)39(45)36-34(40(35)46)30(44-54(49,50)28-19-15-24(2)16-20-28)22-32(38(36)42)52-26-11-7-4-8-12-26/h3-22,43-44H,41-42H2,1-2H3 |
| InChIKey | GAVYGRFACDUNLV-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 196.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.85 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|