C26H20F3NO3S — CID 169370979
4-methyl-N-[2-(4-phenylphenoxy)-5-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 169370979) has the molecular formula C26H20F3NO3S and a molecular weight of 483.51 g/mol. Its IUPAC name is 4-methyl-N-[2-(4-phenylphenoxy)-5-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[2-(4-phenylphenoxy)-5-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 169370979 |
| Molecular Formula | C26H20F3NO3S |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 4-methyl-N-[2-(4-phenylphenoxy)-5-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(C(F)(F)F)ccc2Oc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H20F3NO3S/c1-18-7-14-23(15-8-18)34(31,32)30-24-17-21(26(27,28)29)11-16-25(24)33-22-12-9-20(10-13-22)19-5-3-2-4-6-19/h2-17,30H,1H3 |
| InChIKey | CTIPXGOEDSHNDQ-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |