C19H15Cl2NO3S — CID 169370059
N-[5-chloro-2-(4-chlorophenoxy)phenyl]-4-methylbenzenesulfonamide (PubChem CID 169370059) has the molecular formula C19H15Cl2NO3S and a molecular weight of 408.31 g/mol. Its IUPAC name is N-[5-chloro-2-(4-chlorophenoxy)phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[5-chloro-2-(4-chlorophenoxy)phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 169370059 |
| Molecular Formula | C19H15Cl2NO3S |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | N-[5-chloro-2-(4-chlorophenoxy)phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(Cl)ccc2Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H15Cl2NO3S/c1-13-2-9-17(10-3-13)26(23,24)22-18-12-15(21)6-11-19(18)25-16-7-4-14(20)5-8-16/h2-12,22H,1H3 |
| InChIKey | ZQNPXQVJTVERJP-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |