C21H18ClNO6S — CID 126252916
methyl 2-[4-[(5-chloro-2-phenoxyphenyl)sulfamoyl]phenoxy]acetate (PubChem CID 126252916) has the molecular formula C21H18ClNO6S and a molecular weight of 447.90 g/mol. Its IUPAC name is methyl 2-[4-[(5-chloro-2-phenoxyphenyl)sulfamoyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[(5-chloro-2-phenoxyphenyl)sulfamoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126252916 |
| Molecular Formula | C21H18ClNO6S |
| Molecular Weight | 447.90 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | methyl 2-[4-[(5-chloro-2-phenoxyphenyl)sulfamoyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(S(=O)(=O)Nc2cc(Cl)ccc2Oc2ccccc2)cc1 |
| InChI | InChI=1S/C21H18ClNO6S/c1-27-21(24)14-28-16-8-10-18(11-9-16)30(25,26)23-19-13-15(22)7-12-20(19)29-17-5-3-2-4-6-17/h2-13,23H,14H2,1H3 |
| InChIKey | ATFNQVNQPAINNG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.90 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |