C15H13Cl2NO5S — CID 126120452
methyl 2-[4-[(2,3-dichlorophenyl)sulfamoyl]phenoxy]acetate (PubChem CID 126120452) has the molecular formula C15H13Cl2NO5S and a molecular weight of 390.24 g/mol. Its IUPAC name is methyl 2-[4-[(2,3-dichlorophenyl)sulfamoyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[(2,3-dichlorophenyl)sulfamoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126120452 |
| Molecular Formula | C15H13Cl2NO5S |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | methyl 2-[4-[(2,3-dichlorophenyl)sulfamoyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(S(=O)(=O)Nc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C15H13Cl2NO5S/c1-22-14(19)9-23-10-5-7-11(8-6-10)24(20,21)18-13-4-2-3-12(16)15(13)17/h2-8,18H,9H2,1H3 |
| InChIKey | CNZMSLLOHTUADM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |