C24H18Cl2N2O5S2 — CID 43885647
N-(2,3-dichlorophenyl)-4-[(4-phenoxyphenyl)sulfonylamino]benzenesulfonamide (PubChem CID 43885647) has the molecular formula C24H18Cl2N2O5S2 and a molecular weight of 549.46 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-4-[(4-phenoxyphenyl)sulfonylamino]benzenesulfonamide.
| Compound Name | N-(2,3-dichlorophenyl)-4-[(4-phenoxyphenyl)sulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 43885647 |
| Molecular Formula | C24H18Cl2N2O5S2 |
| Molecular Weight | 549.46 g/mol |
| Exact Mass | 548.00 |
| IUPAC Name | N-(2,3-dichlorophenyl)-4-[(4-phenoxyphenyl)sulfonylamino]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(S(=O)(=O)Nc2cccc(Cl)c2Cl)cc1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C24H18Cl2N2O5S2/c25-22-7-4-8-23(24(22)26)28-35(31,32)20-13-9-17(10-14-20)27-34(29,30)21-15-11-19(12-16-21)33-18-5-2-1-3-6-18/h1-16,27-28H |
| InChIKey | RSFBNVAOLWYTGL-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.46 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |