C18H13Cl2NO3S — CID 21210578
3,4-dichloro-N-(4-phenoxyphenyl)benzenesulfonamide (PubChem CID 21210578) has the molecular formula C18H13Cl2NO3S and a molecular weight of 394.28 g/mol. Its IUPAC name is 3,4-dichloro-N-(4-phenoxyphenyl)benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-(4-phenoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 21210578 |
| Molecular Formula | C18H13Cl2NO3S |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | 3,4-dichloro-N-(4-phenoxyphenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Oc2ccccc2)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H13Cl2NO3S/c19-17-11-10-16(12-18(17)20)25(22,23)21-13-6-8-15(9-7-13)24-14-4-2-1-3-5-14/h1-12,21H |
| InChIKey | FCOQDVHOIAKYNX-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |