C24H17Cl2NO5S2 — CID 25048378
3-(3,4-dichlorophenyl)sulfonyl-N-(4-phenoxyphenyl)benzenesulfonamide (PubChem CID 25048378) has the molecular formula C24H17Cl2NO5S2 and a molecular weight of 534.44 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)sulfonyl-N-(4-phenoxyphenyl)benzenesulfonamide.
| Compound Name | 3-(3,4-dichlorophenyl)sulfonyl-N-(4-phenoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 25048378 |
| Molecular Formula | C24H17Cl2NO5S2 |
| Molecular Weight | 534.44 g/mol |
| Exact Mass | 532.99 |
| IUPAC Name | 3-(3,4-dichlorophenyl)sulfonyl-N-(4-phenoxyphenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Oc2ccccc2)cc1)c1cccc(S(=O)(=O)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C24H17Cl2NO5S2/c25-23-14-13-21(16-24(23)26)33(28,29)20-7-4-8-22(15-20)34(30,31)27-17-9-11-19(12-10-17)32-18-5-2-1-3-6-18/h1-16,27H |
| InChIKey | QVFSRWDMVCFNKW-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.44 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |