C18H12Cl2FNO4S2 — CID 134089881
3-(3,4-dichlorophenyl)sulfonyl-N-(3-fluorophenyl)benzenesulfonamide (PubChem CID 134089881) has the molecular formula C18H12Cl2FNO4S2 and a molecular weight of 460.34 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)sulfonyl-N-(3-fluorophenyl)benzenesulfonamide.
| Compound Name | 3-(3,4-dichlorophenyl)sulfonyl-N-(3-fluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 134089881 |
| Molecular Formula | C18H12Cl2FNO4S2 |
| Molecular Weight | 460.34 g/mol |
| Exact Mass | 458.96 |
| IUPAC Name | 3-(3,4-dichlorophenyl)sulfonyl-N-(3-fluorophenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(F)c1)c1cccc(S(=O)(=O)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C18H12Cl2FNO4S2/c19-17-8-7-15(11-18(17)20)27(23,24)14-5-2-6-16(10-14)28(25,26)22-13-4-1-3-12(21)9-13/h1-11,22H |
| InChIKey | ZVXAOXNYTTUXFJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.34 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |