C19H15Cl2NO2S — CID 3858982
N-(3-benzylphenyl)-3,4-dichlorobenzenesulfonamide (PubChem CID 3858982) has the molecular formula C19H15Cl2NO2S and a molecular weight of 392.31 g/mol. Its IUPAC name is N-(3-benzylphenyl)-3,4-dichlorobenzenesulfonamide.
| Compound Name | N-(3-benzylphenyl)-3,4-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 3858982 |
| Molecular Formula | C19H15Cl2NO2S |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | N-(3-benzylphenyl)-3,4-dichlorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(Cc2ccccc2)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H15Cl2NO2S/c20-18-10-9-17(13-19(18)21)25(23,24)22-16-8-4-7-15(12-16)11-14-5-2-1-3-6-14/h1-10,12-13,22H,11H2 |
| InChIKey | KZHBYOICKBPYON-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |