C16H11BrCl2N2O4S3 — CID 126132426
5-bromo-N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]thiophene-2-sulfonamide (PubChem CID 126132426) has the molecular formula C16H11BrCl2N2O4S3 and a molecular weight of 542.29 g/mol. Its IUPAC name is 5-bromo-N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 126132426 |
| Molecular Formula | C16H11BrCl2N2O4S3 |
| Molecular Weight | 542.29 g/mol |
| Exact Mass | 539.84 |
| IUPAC Name | 5-bromo-N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(Cl)c1Cl)c1ccc(NS(=O)(=O)c2ccc(Br)s2)cc1 |
| InChI | InChI=1S/C16H11BrCl2N2O4S3/c17-14-8-9-15(26-14)28(24,25)20-10-4-6-11(7-5-10)27(22,23)21-13-3-1-2-12(18)16(13)19/h1-9,20-21H |
| InChIKey | NWYPYUPWQLUTPX-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.29 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |