C22H16Cl2N2O4S2 — CID 126387209
N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]naphthalene-2-sulfonamide (PubChem CID 126387209) has the molecular formula C22H16Cl2N2O4S2 and a molecular weight of 507.42 g/mol. Its IUPAC name is N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]naphthalene-2-sulfonamide.
| Compound Name | N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 126387209 |
| Molecular Formula | C22H16Cl2N2O4S2 |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 505.99 |
| IUPAC Name | N-[4-[(2,3-dichlorophenyl)sulfamoyl]phenyl]naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(S(=O)(=O)Nc2cccc(Cl)c2Cl)cc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H16Cl2N2O4S2/c23-20-6-3-7-21(22(20)24)26-31(27,28)18-12-9-17(10-13-18)25-32(29,30)19-11-8-15-4-1-2-5-16(15)14-19/h1-14,25-26H |
| InChIKey | VZXDQMNWDNKCIE-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |