C10H6Cl2FNO2S2 — CID 91969516
N-(2,3-dichlorophenyl)-5-fluorothiophene-2-sulfonamide (PubChem CID 91969516) has the molecular formula C10H6Cl2FNO2S2 and a molecular weight of 326.20 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-5-fluorothiophene-2-sulfonamide.
| Compound Name | N-(2,3-dichlorophenyl)-5-fluorothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 91969516 |
| Molecular Formula | C10H6Cl2FNO2S2 |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 324.92 |
| IUPAC Name | N-(2,3-dichlorophenyl)-5-fluorothiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(Cl)c1Cl)c1ccc(F)s1 |
| InChI | InChI=1S/C10H6Cl2FNO2S2/c11-6-2-1-3-7(10(6)12)14-18(15,16)9-5-4-8(13)17-9/h1-5,14H |
| InChIKey | DWRZABUMIVSNSE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |