C12H6Cl2F3NO2S — CID 2093570
2,3-dichloro-N-(2,3,4-trifluorophenyl)benzenesulfonamide (PubChem CID 2093570) has the molecular formula C12H6Cl2F3NO2S and a molecular weight of 356.15 g/mol. Its IUPAC name is 2,3-dichloro-N-(2,3,4-trifluorophenyl)benzenesulfonamide.
| Compound Name | 2,3-dichloro-N-(2,3,4-trifluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2093570 |
| Molecular Formula | C12H6Cl2F3NO2S |
| Molecular Weight | 356.15 g/mol |
| Exact Mass | 354.94 |
| IUPAC Name | 2,3-dichloro-N-(2,3,4-trifluorophenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)c(F)c1F)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H6Cl2F3NO2S/c13-6-2-1-3-9(10(6)14)21(19,20)18-8-5-4-7(15)11(16)12(8)17/h1-5,18H |
| InChIKey | VLDCMHCSOXOZMF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.15 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|