C12H7Cl2F3N2O2S — CID 166081585
N-(3-amino-2,4,5-trifluorophenyl)-2,3-dichlorobenzenesulfonamide (PubChem CID 166081585) has the molecular formula C12H7Cl2F3N2O2S and a molecular weight of 371.17 g/mol. Its IUPAC name is N-(3-amino-2,4,5-trifluorophenyl)-2,3-dichlorobenzenesulfonamide.
| Compound Name | N-(3-amino-2,4,5-trifluorophenyl)-2,3-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 166081585 |
| Molecular Formula | C12H7Cl2F3N2O2S |
| Molecular Weight | 371.17 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | N-(3-amino-2,4,5-trifluorophenyl)-2,3-dichlorobenzenesulfonamide |
| SMILES | Nc1c(F)c(F)cc(NS(=O)(=O)c2cccc(Cl)c2Cl)c1F |
| InChI | InChI=1S/C12H7Cl2F3N2O2S/c13-5-2-1-3-8(9(5)14)22(20,21)19-7-4-6(15)10(16)12(18)11(7)17/h1-4,19H,18H2 |
| InChIKey | YWZMBDFRAONRIC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.17 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|