C12H8ClF3N2O2S — CID 62810507
5-amino-2-chloro-N-(2,3,5-trifluorophenyl)benzenesulfonamide (PubChem CID 62810507) has the molecular formula C12H8ClF3N2O2S and a molecular weight of 336.72 g/mol. Its IUPAC name is 5-amino-2-chloro-N-(2,3,5-trifluorophenyl)benzenesulfonamide.
| Compound Name | 5-amino-2-chloro-N-(2,3,5-trifluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 62810507 |
| Molecular Formula | C12H8ClF3N2O2S |
| Molecular Weight | 336.72 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | 5-amino-2-chloro-N-(2,3,5-trifluorophenyl)benzenesulfonamide |
| SMILES | Nc1ccc(Cl)c(S(=O)(=O)Nc2cc(F)cc(F)c2F)c1 |
| InChI | InChI=1S/C12H8ClF3N2O2S/c13-8-2-1-7(17)5-11(8)21(19,20)18-10-4-6(14)3-9(15)12(10)16/h1-5,18H,17H2 |
| InChIKey | CCBXRGVCVGARRV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.72 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|