C12H6F3N3O2S — CID 106595373
2-cyano-N-(2,3,4-trifluorophenyl)pyridine-3-sulfonamide (PubChem CID 106595373) has the molecular formula C12H6F3N3O2S and a molecular weight of 313.26 g/mol. Its IUPAC name is 2-cyano-N-(2,3,4-trifluorophenyl)pyridine-3-sulfonamide.
| Compound Name | 2-cyano-N-(2,3,4-trifluorophenyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106595373 |
| Molecular Formula | C12H6F3N3O2S |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 2-cyano-N-(2,3,4-trifluorophenyl)pyridine-3-sulfonamide |
| SMILES | N#Cc1ncccc1S(=O)(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H6F3N3O2S/c13-7-3-4-8(12(15)11(7)14)18-21(19,20)10-2-1-5-17-9(10)6-16/h1-5,18H |
| InChIKey | CEJFSJWIPCZNGU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|